C20H28Cl4N2O2 — CID 17216215
N'-[[2-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-N-methylpropane-1,3-diamine;dihydrochloride (PubChem CID 17216215) has the molecular formula C20H28Cl4N2O2 and a molecular weight of 470.27 g/mol. Its IUPAC name is N'-[[2-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-N-methylpropane-1,3-diamine;dihydrochloride.
| Compound Name | N'-[[2-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-N-methylpropane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17216215 |
| Molecular Formula | C20H28Cl4N2O2 |
| Molecular Weight | 470.27 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | N'-[[2-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-N-methylpropane-1,3-diamine;dihydrochloride |
| SMILES | CCOc1cccc(CNCCCNC)c1OCc1ccc(Cl)cc1Cl.Cl.Cl |
| InChI | InChI=1S/C20H26Cl2N2O2.2ClH/c1-3-25-19-7-4-6-15(13-24-11-5-10-23-2)20(19)26-14-16-8-9-17(21)12-18(16)22;;/h4,6-9,12,23-24H,3,5,10-11,13-14H2,1-2H3;2*1H |
| InChIKey | PSYCQSXQNQLIIH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.27 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|