C20H28Cl4N2O3 — CID 17214062
2-[3-[[2-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylamino]propylamino]ethanol;dihydrochloride (PubChem CID 17214062) has the molecular formula C20H28Cl4N2O3 and a molecular weight of 486.27 g/mol. Its IUPAC name is 2-[3-[[2-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylamino]propylamino]ethanol;dihydrochloride.
| Compound Name | 2-[3-[[2-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylamino]propylamino]ethanol;dihydrochloride |
|---|---|
| PubChem CID | 17214062 |
| Molecular Formula | C20H28Cl4N2O3 |
| Molecular Weight | 486.27 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | 2-[3-[[2-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylamino]propylamino]ethanol;dihydrochloride |
| SMILES | COc1cccc(CNCCCNCCO)c1OCc1ccc(Cl)cc1Cl.Cl.Cl |
| InChI | InChI=1S/C20H26Cl2N2O3.2ClH/c1-26-19-5-2-4-15(13-24-9-3-8-23-10-11-25)20(19)27-14-16-6-7-17(21)12-18(16)22;;/h2,4-7,12,23-25H,3,8-11,13-14H2,1H3;2*1H |
| InChIKey | IEYPPTJPTHVVBW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.27 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|