C23H29Cl3N2O3 — CID 4722106
N-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-morpholin-4-ylpropan-1-amine (PubChem CID 4722106) has the molecular formula C23H29Cl3N2O3 and a molecular weight of 487.86 g/mol. Its IUPAC name is N-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-morpholin-4-ylpropan-1-amine.
| Compound Name | N-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-morpholin-4-ylpropan-1-amine |
|---|---|
| PubChem CID | 4722106 |
| Molecular Formula | C23H29Cl3N2O3 |
| Molecular Weight | 487.86 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | N-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-3-morpholin-4-ylpropan-1-amine |
| SMILES | CCOc1cc(CNCCCN2CCOCC2)cc(Cl)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H29Cl3N2O3/c1-2-30-22-13-17(15-27-6-3-7-28-8-10-29-11-9-28)12-21(26)23(22)31-16-18-4-5-19(24)14-20(18)25/h4-5,12-14,27H,2-3,6-11,15-16H2,1H3 |
| InChIKey | HTYNAEAKCRGZOM-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.86 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|