C22H30Cl3FN2O3 — CID 17295333
N-[[3-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-morpholin-4-ylethanamine;dihydrochloride (PubChem CID 17295333) has the molecular formula C22H30Cl3FN2O3 and a molecular weight of 495.85 g/mol. Its IUPAC name is N-[[3-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-morpholin-4-ylethanamine;dihydrochloride.
| Compound Name | N-[[3-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-morpholin-4-ylethanamine;dihydrochloride |
|---|---|
| PubChem CID | 17295333 |
| Molecular Formula | C22H30Cl3FN2O3 |
| Molecular Weight | 495.85 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | N-[[3-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-morpholin-4-ylethanamine;dihydrochloride |
| SMILES | CCOc1cc(CNCCN2CCOCC2)cc(Cl)c1OCc1ccc(F)cc1.Cl.Cl |
| InChI | InChI=1S/C22H28ClFN2O3.2ClH/c1-2-28-21-14-18(15-25-7-8-26-9-11-27-12-10-26)13-20(23)22(21)29-16-17-3-5-19(24)6-4-17;;/h3-6,13-14,25H,2,7-12,15-16H2,1H3;2*1H |
| InChIKey | YNOSYXAWVKKJLA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.85 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|