C23H21Cl3INO2 — CID 126127342
3-chloro-N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methyl]-2-methylaniline (PubChem CID 126127342) has the molecular formula C23H21Cl3INO2 and a molecular weight of 576.69 g/mol. Its IUPAC name is 3-chloro-N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methyl]-2-methylaniline.
| Compound Name | 3-chloro-N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methyl]-2-methylaniline |
|---|---|
| PubChem CID | 126127342 |
| Molecular Formula | C23H21Cl3INO2 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 574.97 |
| IUPAC Name | 3-chloro-N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methyl]-2-methylaniline |
| SMILES | CCOc1cc(CNc2cccc(Cl)c2C)cc(I)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H21Cl3INO2/c1-3-29-22-10-15(12-28-21-6-4-5-18(25)14(21)2)9-20(27)23(22)30-13-16-7-8-17(24)11-19(16)26/h4-11,28H,3,12-13H2,1-2H3 |
| InChIKey | XTQPMKZDOSYDEA-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|