C23H22Cl2INO2 — CID 126127015
N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methyl]-3-methylaniline (PubChem CID 126127015) has the molecular formula C23H22Cl2INO2 and a molecular weight of 542.24 g/mol. Its IUPAC name is N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methyl]-3-methylaniline.
| Compound Name | N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methyl]-3-methylaniline |
|---|---|
| PubChem CID | 126127015 |
| Molecular Formula | C23H22Cl2INO2 |
| Molecular Weight | 542.24 g/mol |
| Exact Mass | 541.01 |
| IUPAC Name | N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methyl]-3-methylaniline |
| SMILES | CCOc1cc(CNc2cccc(C)c2)cc(I)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H22Cl2INO2/c1-3-28-22-11-16(13-27-19-6-4-5-15(2)9-19)10-21(26)23(22)29-14-17-7-8-18(24)12-20(17)25/h4-12,27H,3,13-14H2,1-2H3 |
| InChIKey | SARHIMKMDXQYQZ-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.24 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|