C27H30ClNO3 — CID 126124704
N-[[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methyl]-4-ethoxyaniline (PubChem CID 126124704) has the molecular formula C27H30ClNO3 and a molecular weight of 451.99 g/mol. Its IUPAC name is N-[[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methyl]-4-ethoxyaniline.
| Compound Name | N-[[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methyl]-4-ethoxyaniline |
|---|---|
| PubChem CID | 126124704 |
| Molecular Formula | C27H30ClNO3 |
| Molecular Weight | 451.99 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | N-[[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methyl]-4-ethoxyaniline |
| SMILES | C=CCc1cc(CNc2ccc(OCC)cc2)cc(OCC)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C27H30ClNO3/c1-4-9-21-16-20(18-29-23-12-14-24(15-13-23)30-5-2)17-26(31-6-3)27(21)32-19-22-10-7-8-11-25(22)28/h4,7-8,10-17,29H,1,5-6,9,18-19H2,2-3H3 |
| InChIKey | PVFCWRIROFWBSO-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.99 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|