C25H27NO4S — CID 126118827
[2-ethoxy-4-[(2-methylanilino)methyl]-6-prop-2-enylphenyl] benzenesulfonate (PubChem CID 126118827) has the molecular formula C25H27NO4S and a molecular weight of 437.56 g/mol. Its IUPAC name is [2-ethoxy-4-[(2-methylanilino)methyl]-6-prop-2-enylphenyl] benzenesulfonate.
| Compound Name | [2-ethoxy-4-[(2-methylanilino)methyl]-6-prop-2-enylphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126118827 |
| Molecular Formula | C25H27NO4S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | [2-ethoxy-4-[(2-methylanilino)methyl]-6-prop-2-enylphenyl] benzenesulfonate |
| SMILES | C=CCc1cc(CNc2ccccc2C)cc(OCC)c1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H27NO4S/c1-4-11-21-16-20(18-26-23-15-10-9-12-19(23)3)17-24(29-5-2)25(21)30-31(27,28)22-13-7-6-8-14-22/h4,6-10,12-17,26H,1,5,11,18H2,2-3H3 |
| InChIKey | GNBCHNPKXAXUBI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|