C26H28ClNO4S — CID 126119887
[4-[(3,4-dimethylanilino)methyl]-2-ethoxy-6-prop-2-enylphenyl] 4-chlorobenzenesulfonate (PubChem CID 126119887) has the molecular formula C26H28ClNO4S and a molecular weight of 486.03 g/mol. Its IUPAC name is [4-[(3,4-dimethylanilino)methyl]-2-ethoxy-6-prop-2-enylphenyl] 4-chlorobenzenesulfonate.
| Compound Name | [4-[(3,4-dimethylanilino)methyl]-2-ethoxy-6-prop-2-enylphenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126119887 |
| Molecular Formula | C26H28ClNO4S |
| Molecular Weight | 486.03 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | [4-[(3,4-dimethylanilino)methyl]-2-ethoxy-6-prop-2-enylphenyl] 4-chlorobenzenesulfonate |
| SMILES | C=CCc1cc(CNc2ccc(C)c(C)c2)cc(OCC)c1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H28ClNO4S/c1-5-7-21-15-20(17-28-23-11-8-18(3)19(4)14-23)16-25(31-6-2)26(21)32-33(29,30)24-12-9-22(27)10-13-24/h5,8-16,28H,1,6-7,17H2,2-4H3 |
| InChIKey | HHLRHRHYDSVKQO-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.03 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|