C30H29NO5S — CID 126127354
[2-ethoxy-4-[(4-phenoxyanilino)methyl]-6-prop-2-enylphenyl] benzenesulfonate (PubChem CID 126127354) has the molecular formula C30H29NO5S and a molecular weight of 515.63 g/mol. Its IUPAC name is [2-ethoxy-4-[(4-phenoxyanilino)methyl]-6-prop-2-enylphenyl] benzenesulfonate.
| Compound Name | [2-ethoxy-4-[(4-phenoxyanilino)methyl]-6-prop-2-enylphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126127354 |
| Molecular Formula | C30H29NO5S |
| Molecular Weight | 515.63 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | [2-ethoxy-4-[(4-phenoxyanilino)methyl]-6-prop-2-enylphenyl] benzenesulfonate |
| SMILES | C=CCc1cc(CNc2ccc(Oc3ccccc3)cc2)cc(OCC)c1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H29NO5S/c1-3-11-24-20-23(22-31-25-16-18-27(19-17-25)35-26-12-7-5-8-13-26)21-29(34-4-2)30(24)36-37(32,33)28-14-9-6-10-15-28/h3,5-10,12-21,31H,1,4,11,22H2,2H3 |
| InChIKey | VQARPKZCQUDNSG-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.63 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|