C26H29NO4S — CID 126121845
[2-ethoxy-4-[(4-ethylanilino)methyl]-6-prop-2-enylphenyl] benzenesulfonate (PubChem CID 126121845) has the molecular formula C26H29NO4S and a molecular weight of 451.59 g/mol. Its IUPAC name is [2-ethoxy-4-[(4-ethylanilino)methyl]-6-prop-2-enylphenyl] benzenesulfonate.
| Compound Name | [2-ethoxy-4-[(4-ethylanilino)methyl]-6-prop-2-enylphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126121845 |
| Molecular Formula | C26H29NO4S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | [2-ethoxy-4-[(4-ethylanilino)methyl]-6-prop-2-enylphenyl] benzenesulfonate |
| SMILES | C=CCc1cc(CNc2ccc(CC)cc2)cc(OCC)c1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H29NO4S/c1-4-10-22-17-21(19-27-23-15-13-20(5-2)14-16-23)18-25(30-6-3)26(22)31-32(28,29)24-11-8-7-9-12-24/h4,7-9,11-18,27H,1,5-6,10,19H2,2-3H3 |
| InChIKey | RYGWURPEZZODJE-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|