C17H28N4O2 — CID 18980285
N-[3-(2-methoxyphenoxy)propyl]-N'-(1,4,5,6-tetrahydropyrimidin-2-yl)propane-1,3-diamine (PubChem CID 18980285) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is N-[3-(2-methoxyphenoxy)propyl]-N'-(1,4,5,6-tetrahydropyrimidin-2-yl)propane-1,3-diamine.
| Compound Name | N-[3-(2-methoxyphenoxy)propyl]-N'-(1,4,5,6-tetrahydropyrimidin-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 18980285 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | N-[3-(2-methoxyphenoxy)propyl]-N'-(1,4,5,6-tetrahydropyrimidin-2-yl)propane-1,3-diamine |
| SMILES | COc1ccccc1OCCCNCCCNC1=NCCCN1 |
| InChI | InChI=1S/C17H28N4O2/c1-22-15-7-2-3-8-16(15)23-14-6-10-18-9-4-11-19-17-20-12-5-13-21-17/h2-3,7-8,18H,4-6,9-14H2,1H3,(H2,19,20,21) |
| InChIKey | SFRJCDDYUYKKMK-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|