C13H18FN3O — CID 51131536
N-[3-(4-fluorophenoxy)propyl]-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 51131536) has the molecular formula C13H18FN3O and a molecular weight of 251.30 g/mol. Its IUPAC name is N-[3-(4-fluorophenoxy)propyl]-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | N-[3-(4-fluorophenoxy)propyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 51131536 |
| Molecular Formula | C13H18FN3O |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | N-[3-(4-fluorophenoxy)propyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | C1CNC(=NC1)NCCCOC2=CC=C(C=C2)F |
| InChI | InChI=1S/C13H18FN3O/c14-11-3-5-12(6-4-11)18-10-2-9-17-13-15-7-1-8-16-13/h3-6H,1-2,7-10H2,(H2,15,16,17) |
| InChIKey | VPUGAEUZOBYKAJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 45.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | 265 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|