C12H8ClF3N2 — CID 163207536
N-[(6-chloro-3-pyridinyl)methyl]-2,3,4-trifluoroaniline (PubChem CID 163207536) has the molecular formula C12H8ClF3N2 and a molecular weight of 272.66 g/mol. Its IUPAC name is N-[(6-chloro-3-pyridinyl)methyl]-2,3,4-trifluoroaniline.
| Compound Name | N-[(6-chloro-3-pyridinyl)methyl]-2,3,4-trifluoroaniline |
|---|---|
| PubChem CID | 163207536 |
| Molecular Formula | C12H8ClF3N2 |
| Molecular Weight | 272.66 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | N-[(6-chloro-3-pyridinyl)methyl]-2,3,4-trifluoroaniline |
| SMILES | Fc1ccc(NCc2ccc(Cl)nc2)c(F)c1F |
| InChI | InChI=1S/C12H8ClF3N2/c13-10-4-1-7(6-18-10)5-17-9-3-2-8(14)11(15)12(9)16/h1-4,6,17H,5H2 |
| InChIKey | VNIOZBBRTDUWMV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.66 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|