C7H6ClN2SSi — CID 163533915
CID 163533915 (PubChem CID 163533915) has the molecular formula C7H6ClN2SSi and a molecular weight of 213.75 g/mol.
| Compound Name | CID 163533915 |
|---|---|
| PubChem CID | 163533915 |
| Molecular Formula | C7H6ClN2SSi |
| Molecular Weight | 213.75 g/mol |
| Exact Mass | 212.97 |
| IUPAC Name | — |
| SMILES | [Si]C(=S)NCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C7H6ClN2SSi/c8-6-2-1-5(3-9-6)4-10-7(11)12/h1-3H,4H2,(H,10,11) |
| InChIKey | XMSZRGWRUUBKQC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.75 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|