C14H15ClN2 — CID 143694179
(3E,5Z)-N-[(6-chloro-3-pyridinyl)methyl]octa-1,3,5,7-tetraen-4-amine (PubChem CID 143694179) has the molecular formula C14H15ClN2 and a molecular weight of 246.74 g/mol. Its IUPAC name is (3E,5Z)-N-[(6-chloro-3-pyridinyl)methyl]octa-1,3,5,7-tetraen-4-amine.
| Compound Name | (3E,5Z)-N-[(6-chloro-3-pyridinyl)methyl]octa-1,3,5,7-tetraen-4-amine |
|---|---|
| PubChem CID | 143694179 |
| Molecular Formula | C14H15ClN2 |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (3E,5Z)-N-[(6-chloro-3-pyridinyl)methyl]octa-1,3,5,7-tetraen-4-amine |
| SMILES | C=C/C=C\C(=C/C=C)NCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C14H15ClN2/c1-3-5-7-13(6-4-2)16-10-12-8-9-14(15)17-11-12/h3-9,11,16H,1-2,10H2/b7-5-,13-6+ |
| InChIKey | AGQMFXBUBZWBRR-IILXRZLBSA-N |
| XLogP | 3.64 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|