C19H25F3N2O — CID 143696197
ethane;(3Z,5E,7Z)-N-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]nona-1,3,5,7-tetraen-5-amine (PubChem CID 143696197) has the molecular formula C19H25F3N2O and a molecular weight of 354.42 g/mol. Its IUPAC name is ethane;(3Z,5E,7Z)-N-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]nona-1,3,5,7-tetraen-5-amine.
| Compound Name | ethane;(3Z,5E,7Z)-N-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]nona-1,3,5,7-tetraen-5-amine |
|---|---|
| PubChem CID | 143696197 |
| Molecular Formula | C19H25F3N2O |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | ethane;(3Z,5E,7Z)-N-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]nona-1,3,5,7-tetraen-5-amine |
| SMILES | C=C/C=C\C(=C/C=C\C)NCc1ccc(OCC(F)(F)F)nc1.CC |
| InChI | InChI=1S/C17H19F3N2O.C2H6/c1-3-5-7-15(8-6-4-2)21-11-14-9-10-16(22-12-14)23-13-17(18,19)20;1-2/h3-10,12,21H,1,11,13H2,2H3;1-2H3/b6-4-,7-5-,15-8+; |
| InChIKey | ZHJVPRWWMBXSTD-UCDXSBDDSA-N |
| XLogP | 5.34 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|