C14H15F3N2 — CID 143694266
(3E,5Z)-N-[[6-(trifluoromethyl)-3-pyridinyl]methyl]hepta-1,3,5-trien-4-amine (PubChem CID 143694266) has the molecular formula C14H15F3N2 and a molecular weight of 268.28 g/mol. Its IUPAC name is (3E,5Z)-N-[[6-(trifluoromethyl)-3-pyridinyl]methyl]hepta-1,3,5-trien-4-amine.
| Compound Name | (3E,5Z)-N-[[6-(trifluoromethyl)-3-pyridinyl]methyl]hepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 143694266 |
| Molecular Formula | C14H15F3N2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (3E,5Z)-N-[[6-(trifluoromethyl)-3-pyridinyl]methyl]hepta-1,3,5-trien-4-amine |
| SMILES | C=C/C=C(\C=C/C)NCc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C14H15F3N2/c1-3-5-12(6-4-2)18-9-11-7-8-13(19-10-11)14(15,16)17/h3-8,10,18H,1,9H2,2H3/b6-4-,12-5+ |
| InChIKey | LTEGCFSNUFLCAC-GLNLJRCCSA-N |
| XLogP | 3.84 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|