C12H14F3N3O — CID 171823618
N-methyl-N'-[[6-(trifluoromethyl)-3-pyridinyl]methyl]cyclopropanecarbohydrazide (PubChem CID 171823618) has the molecular formula C12H14F3N3O and a molecular weight of 273.26 g/mol. Its IUPAC name is N-methyl-N'-[[6-(trifluoromethyl)-3-pyridinyl]methyl]cyclopropanecarbohydrazide.
| Compound Name | N-methyl-N'-[[6-(trifluoromethyl)-3-pyridinyl]methyl]cyclopropanecarbohydrazide |
|---|---|
| PubChem CID | 171823618 |
| Molecular Formula | C12H14F3N3O |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-methyl-N'-[[6-(trifluoromethyl)-3-pyridinyl]methyl]cyclopropanecarbohydrazide |
| SMILES | CN(NCc1ccc(C(F)(F)F)nc1)C(=O)C1CC1 |
| InChI | InChI=1S/C12H14F3N3O/c1-18(11(19)9-3-4-9)17-7-8-2-5-10(16-6-8)12(13,14)15/h2,5-6,9,17H,3-4,7H2,1H3 |
| InChIKey | OHWNREYHMJQEPR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|