C13H14F4N2O — CID 171822920
N'-[dideuterio-[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-N-methylcyclopropanecarbohydrazide (PubChem CID 171822920) has the molecular formula C13H14F4N2O and a molecular weight of 292.27 g/mol. Its IUPAC name is N'-[dideuterio-[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-N-methylcyclopropanecarbohydrazide.
| Compound Name | N'-[dideuterio-[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-N-methylcyclopropanecarbohydrazide |
|---|---|
| PubChem CID | 171822920 |
| Molecular Formula | C13H14F4N2O |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | N'-[dideuterio-[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-N-methylcyclopropanecarbohydrazide |
| SMILES | [2H]C([2H])(NN(C)C(=O)C1CC1)c1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C13H14F4N2O/c1-19(12(20)8-2-3-8)18-7-9-4-5-10(6-11(9)14)13(15,16)17/h4-6,8,18H,2-3,7H2,1H3/i7D2 |
| InChIKey | OPROEVPPLIWHLK-RJSZUWSASA-N |
| XLogP | 2.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|