C13H16F4N2O2 — CID 171823598
N-[[2-fluoro-4-(trifluoromethyl)phenyl]methylamino]-N-methylformamide;oxetane (PubChem CID 171823598) has the molecular formula C13H16F4N2O2 and a molecular weight of 308.27 g/mol. Its IUPAC name is N-[[2-fluoro-4-(trifluoromethyl)phenyl]methylamino]-N-methylformamide;oxetane.
| Compound Name | N-[[2-fluoro-4-(trifluoromethyl)phenyl]methylamino]-N-methylformamide;oxetane |
|---|---|
| PubChem CID | 171823598 |
| Molecular Formula | C13H16F4N2O2 |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | N-[[2-fluoro-4-(trifluoromethyl)phenyl]methylamino]-N-methylformamide;oxetane |
| SMILES | C1COC1.CN(C=O)NCc1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C10H10F4N2O.C3H6O/c1-16(6-17)15-5-7-2-3-8(4-9(7)11)10(12,13)14;1-2-4-3-1/h2-4,6,15H,5H2,1H3;1-3H2 |
| InChIKey | ILLULGPFAGGMIS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|