C14H18F4N2O — CID 3790964
1-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-3-pentylurea (PubChem CID 3790964) has the molecular formula C14H18F4N2O and a molecular weight of 306.30 g/mol. Its IUPAC name is 1-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-3-pentylurea.
| Compound Name | 1-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-3-pentylurea |
|---|---|
| PubChem CID | 3790964 |
| Molecular Formula | C14H18F4N2O |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 1-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-3-pentylurea |
| SMILES | CCCCCNC(=O)NCc1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C14H18F4N2O/c1-2-3-4-7-19-13(21)20-9-10-5-6-11(8-12(10)15)14(16,17)18/h5-6,8H,2-4,7,9H2,1H3,(H2,19,20,21) |
| InChIKey | YWTWNCASICVGLR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|