C18H16F4N2O3 — CID 3733924
ethyl 3-[[2-fluoro-4-(trifluoromethyl)phenyl]methylcarbamoylamino]benzoate (PubChem CID 3733924) has the molecular formula C18H16F4N2O3 and a molecular weight of 384.33 g/mol. Its IUPAC name is ethyl 3-[[2-fluoro-4-(trifluoromethyl)phenyl]methylcarbamoylamino]benzoate.
| Compound Name | ethyl 3-[[2-fluoro-4-(trifluoromethyl)phenyl]methylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 3733924 |
| Molecular Formula | C18H16F4N2O3 |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | ethyl 3-[[2-fluoro-4-(trifluoromethyl)phenyl]methylcarbamoylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)NCc2ccc(C(F)(F)F)cc2F)c1 |
| InChI | InChI=1S/C18H16F4N2O3/c1-2-27-16(25)11-4-3-5-14(8-11)24-17(26)23-10-12-6-7-13(9-15(12)19)18(20,21)22/h3-9H,2,10H2,1H3,(H2,23,24,26) |
| InChIKey | YOUXJBSSRHBMTE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |