C14H9Cl2F4N3O — CID 3692964
1-(2,6-dichloro-4-pyridinyl)-3-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 3692964) has the molecular formula C14H9Cl2F4N3O and a molecular weight of 382.14 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-pyridinyl)-3-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 1-(2,6-dichloro-4-pyridinyl)-3-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 3692964 |
| Molecular Formula | C14H9Cl2F4N3O |
| Molecular Weight | 382.14 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 1-(2,6-dichloro-4-pyridinyl)-3-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | O=C(NCc1ccc(C(F)(F)F)cc1F)Nc1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C14H9Cl2F4N3O/c15-11-4-9(5-12(16)23-11)22-13(24)21-6-7-1-2-8(3-10(7)17)14(18,19)20/h1-5H,6H2,(H2,21,22,23,24) |
| InChIKey | VKMXCELUMUTXAV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.14 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|