C15H11ClF4N2O — CID 3793083
1-[(2-chloro-6-fluorophenyl)methyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 3793083) has the molecular formula C15H11ClF4N2O and a molecular weight of 346.71 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 3793083 |
| Molecular Formula | C15H11ClF4N2O |
| Molecular Weight | 346.71 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCc1c(F)cccc1Cl)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H11ClF4N2O/c16-12-5-2-6-13(17)11(12)8-21-14(23)22-10-4-1-3-9(7-10)15(18,19)20/h1-7H,8H2,(H2,21,22,23) |
| InChIKey | JMWRQWWGVAUBRI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.71 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |