C16H17Cl2N3O — CID 66941489
1-[3-(2-aminoethyl)phenyl]-3-[(2,6-dichlorophenyl)methyl]urea (PubChem CID 66941489) has the molecular formula C16H17Cl2N3O and a molecular weight of 338.24 g/mol. Its IUPAC name is 1-[3-(2-aminoethyl)phenyl]-3-[(2,6-dichlorophenyl)methyl]urea.
| Compound Name | 1-[3-(2-aminoethyl)phenyl]-3-[(2,6-dichlorophenyl)methyl]urea |
|---|---|
| PubChem CID | 66941489 |
| Molecular Formula | C16H17Cl2N3O |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 1-[3-(2-aminoethyl)phenyl]-3-[(2,6-dichlorophenyl)methyl]urea |
| SMILES | NCCc1cccc(NC(=O)NCc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C16H17Cl2N3O/c17-14-5-2-6-15(18)13(14)10-20-16(22)21-12-4-1-3-11(9-12)7-8-19/h1-6,9H,7-8,10,19H2,(H2,20,21,22) |
| InChIKey | GQEIALAROIPRAA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |