C17H21N3O — CID 107654561
1-[3-(3-aminopropyl)phenyl]-3-benzylurea (PubChem CID 107654561) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 1-[3-(3-aminopropyl)phenyl]-3-benzylurea.
| Compound Name | 1-[3-(3-aminopropyl)phenyl]-3-benzylurea |
|---|---|
| PubChem CID | 107654561 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 1-[3-(3-aminopropyl)phenyl]-3-benzylurea |
| SMILES | NCCCc1cccc(NC(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C17H21N3O/c18-11-5-9-14-8-4-10-16(12-14)20-17(21)19-13-15-6-2-1-3-7-15/h1-4,6-8,10,12H,5,9,11,13,18H2,(H2,19,20,21) |
| InChIKey | FQLVQUWGCJQWAF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |