C18H22N4O2 — CID 151709013
N-[3-[2-[4-[(hydrazinecarbonylamino)methyl]phenyl]ethyl]phenyl]acetamide (PubChem CID 151709013) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[3-[2-[4-[(hydrazinecarbonylamino)methyl]phenyl]ethyl]phenyl]acetamide.
| Compound Name | N-[3-[2-[4-[(hydrazinecarbonylamino)methyl]phenyl]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 151709013 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N-[3-[2-[4-[(hydrazinecarbonylamino)methyl]phenyl]ethyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(CCc2ccc(CNC(=O)NN)cc2)c1 |
| InChI | InChI=1S/C18H22N4O2/c1-13(23)21-17-4-2-3-15(11-17)8-5-14-6-9-16(10-7-14)12-20-18(24)22-19/h2-4,6-7,9-11H,5,8,12,19H2,1H3,(H,21,23)(H2,20,22,24) |
| InChIKey | RGDUCBDMRLBJLK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|