C22H22FN3O3 — CID 20951432
ethyl 3-[[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methylcarbamoylamino]benzoate (PubChem CID 20951432) has the molecular formula C22H22FN3O3 and a molecular weight of 395.43 g/mol. Its IUPAC name is ethyl 3-[[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methylcarbamoylamino]benzoate.
| Compound Name | ethyl 3-[[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 20951432 |
| Molecular Formula | C22H22FN3O3 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | ethyl 3-[[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methylcarbamoylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)NCc2cccn2Cc2ccccc2F)c1 |
| InChI | InChI=1S/C22H22FN3O3/c1-2-29-21(27)16-8-5-9-18(13-16)25-22(28)24-14-19-10-6-12-26(19)15-17-7-3-4-11-20(17)23/h3-13H,2,14-15H2,1H3,(H2,24,25,28) |
| InChIKey | LKVAWMLWJXUYMH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |