C12H12F4N2O2 — CID 119072217
N-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-3-hydroxyazetidine-1-carboxamide (PubChem CID 119072217) has the molecular formula C12H12F4N2O2 and a molecular weight of 292.23 g/mol. Its IUPAC name is N-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-3-hydroxyazetidine-1-carboxamide.
| Compound Name | N-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-3-hydroxyazetidine-1-carboxamide |
|---|---|
| PubChem CID | 119072217 |
| Molecular Formula | C12H12F4N2O2 |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | N-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-3-hydroxyazetidine-1-carboxamide |
| SMILES | O=C(NCc1ccc(C(F)(F)F)cc1F)N1CC(O)C1 |
| InChI | InChI=1S/C12H12F4N2O2/c13-10-3-8(12(14,15)16)2-1-7(10)4-17-11(20)18-5-9(19)6-18/h1-3,9,19H,4-6H2,(H,17,20) |
| InChIKey | MQERXTZUMADZKR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |