C13H16F4N2O — CID 3468600
1-butyl-3-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 3468600) has the molecular formula C13H16F4N2O and a molecular weight of 292.28 g/mol. Its IUPAC name is 1-butyl-3-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 1-butyl-3-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 3468600 |
| Molecular Formula | C13H16F4N2O |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 1-butyl-3-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | CCCCNC(=O)NCc1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C13H16F4N2O/c1-2-3-6-18-12(20)19-8-9-7-10(13(15,16)17)4-5-11(9)14/h4-5,7H,2-3,6,8H2,1H3,(H2,18,19,20) |
| InChIKey | ZJTUQIHPPHLLIM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|