C12H14F3N3O3 — CID 171822903
N'-[dihydroxy-[5-(trifluoromethyl)-2-pyridinyl]methyl]-N-methylcyclopropanecarbohydrazide (PubChem CID 171822903) has the molecular formula C12H14F3N3O3 and a molecular weight of 305.26 g/mol. Its IUPAC name is N'-[dihydroxy-[5-(trifluoromethyl)-2-pyridinyl]methyl]-N-methylcyclopropanecarbohydrazide.
| Compound Name | N'-[dihydroxy-[5-(trifluoromethyl)-2-pyridinyl]methyl]-N-methylcyclopropanecarbohydrazide |
|---|---|
| PubChem CID | 171822903 |
| Molecular Formula | C12H14F3N3O3 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N'-[dihydroxy-[5-(trifluoromethyl)-2-pyridinyl]methyl]-N-methylcyclopropanecarbohydrazide |
| SMILES | CN(NC(O)(O)c1ccc(C(F)(F)F)cn1)C(=O)C1CC1 |
| InChI | InChI=1S/C12H14F3N3O3/c1-18(10(19)7-2-3-7)17-12(20,21)9-5-4-8(6-16-9)11(13,14)15/h4-7,17,20-21H,2-3H2,1H3 |
| InChIKey | WKBPNGBZTMJZGW-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|