C13H10F4O3 — CID 175237979
[2-[2-fluoro-4-(trifluoromethyl)phenyl]acetyl] cyclopropanecarboxylate (PubChem CID 175237979) has the molecular formula C13H10F4O3 and a molecular weight of 290.21 g/mol. Its IUPAC name is [2-[2-fluoro-4-(trifluoromethyl)phenyl]acetyl] cyclopropanecarboxylate.
| Compound Name | [2-[2-fluoro-4-(trifluoromethyl)phenyl]acetyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 175237979 |
| Molecular Formula | C13H10F4O3 |
| Molecular Weight | 290.21 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | [2-[2-fluoro-4-(trifluoromethyl)phenyl]acetyl] cyclopropanecarboxylate |
| SMILES | O=C(Cc1ccc(C(F)(F)F)cc1F)OC(=O)C1CC1 |
| InChI | InChI=1S/C13H10F4O3/c14-10-6-9(13(15,16)17)4-3-8(10)5-11(18)20-12(19)7-1-2-7/h3-4,6-7H,1-2,5H2 |
| InChIKey | WBCKARZJIPPQMM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|