C11H10F4O — CID 117339846
1-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]cyclopropan-1-ol (PubChem CID 117339846) has the molecular formula C11H10F4O and a molecular weight of 234.19 g/mol. Its IUPAC name is 1-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]cyclopropan-1-ol.
| Compound Name | 1-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]cyclopropan-1-ol |
|---|---|
| PubChem CID | 117339846 |
| Molecular Formula | C11H10F4O |
| Molecular Weight | 234.19 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 1-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]cyclopropan-1-ol |
| SMILES | OC1(Cc2ccc(C(F)(F)F)cc2F)CC1 |
| InChI | InChI=1S/C11H10F4O/c12-9-5-8(11(13,14)15)2-1-7(9)6-10(16)3-4-10/h1-2,5,16H,3-4,6H2 |
| InChIKey | LVCDHVHXZXHAMS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.19 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |