C12H12F4O — CID 155024076
1-(cyclobutyloxymethyl)-2-fluoro-4-(trifluoromethyl)benzene (PubChem CID 155024076) has the molecular formula C12H12F4O and a molecular weight of 248.22 g/mol. Its IUPAC name is 1-(cyclobutyloxymethyl)-2-fluoro-4-(trifluoromethyl)benzene.
| Compound Name | 1-(cyclobutyloxymethyl)-2-fluoro-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 155024076 |
| Molecular Formula | C12H12F4O |
| Molecular Weight | 248.22 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 1-(cyclobutyloxymethyl)-2-fluoro-4-(trifluoromethyl)benzene |
| SMILES | Fc1cc(C(F)(F)F)ccc1COC1CCC1 |
| InChI | InChI=1S/C12H12F4O/c13-11-6-9(12(14,15)16)5-4-8(11)7-17-10-2-1-3-10/h4-6,10H,1-3,7H2 |
| InChIKey | MFQRNHYDXXAPIH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.22 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |