C20H24F4N2O3 — CID 159059374
[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-[3-[[2-fluoro-4-(trifluoromethyl)phenyl]methoxy]azetidin-1-yl]methanone (PubChem CID 159059374) has the molecular formula C20H24F4N2O3 and a molecular weight of 416.42 g/mol. Its IUPAC name is [(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-[3-[[2-fluoro-4-(trifluoromethyl)phenyl]methoxy]azetidin-1-yl]methanone.
| Compound Name | [(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-[3-[[2-fluoro-4-(trifluoromethyl)phenyl]methoxy]azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 159059374 |
| Molecular Formula | C20H24F4N2O3 |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | [(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-6-yl]-[3-[[2-fluoro-4-(trifluoromethyl)phenyl]methoxy]azetidin-1-yl]methanone |
| SMILES | O=C(N1CC(OCc2ccc(C(F)(F)F)cc2F)C1)N1CC[C@H]2OCCC[C@@H]2C1 |
| InChI | InChI=1S/C20H24F4N2O3/c21-17-8-15(20(22,23)24)4-3-14(17)12-29-16-10-26(11-16)19(27)25-6-5-18-13(9-25)2-1-7-28-18/h3-4,8,13,16,18H,1-2,5-7,9-12H2/t13-,18-/m1/s1 |
| InChIKey | JYGNOUQMSFAHGV-FZKQIMNGSA-N |
| XLogP | 3.67 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |