C20H22ClF3N2O4 — CID 160599739
(4aR,8aS)-6-[3-[[2-chloro-4-(trifluoromethyl)phenyl]methoxy]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one (PubChem CID 160599739) has the molecular formula C20H22ClF3N2O4 and a molecular weight of 446.85 g/mol. Its IUPAC name is (4aR,8aS)-6-[3-[[2-chloro-4-(trifluoromethyl)phenyl]methoxy]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one.
| Compound Name | (4aR,8aS)-6-[3-[[2-chloro-4-(trifluoromethyl)phenyl]methoxy]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
|---|---|
| PubChem CID | 160599739 |
| Molecular Formula | C20H22ClF3N2O4 |
| Molecular Weight | 446.85 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | (4aR,8aS)-6-[3-[[2-chloro-4-(trifluoromethyl)phenyl]methoxy]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
| SMILES | O=C1CO[C@H]2CCN(C(=O)N3CC(OCc4ccc(C(F)(F)F)cc4Cl)C3)C[C@H]2C1 |
| InChI | InChI=1S/C20H22ClF3N2O4/c21-17-6-14(20(22,23)24)2-1-12(17)10-29-16-8-26(9-16)19(28)25-4-3-18-13(7-25)5-15(27)11-30-18/h1-2,6,13,16,18H,3-5,7-11H2/t13-,18+/m1/s1 |
| InChIKey | RECNABLIQNUFRB-ACJLOTCBSA-N |
| XLogP | 3.36 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.85 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |