C15H14F3N3O — CID 71197021
4-(methylamino)-N-[[6-(trifluoromethyl)-3-pyridinyl]methyl]benzamide (PubChem CID 71197021) has the molecular formula C15H14F3N3O and a molecular weight of 309.29 g/mol. Its IUPAC name is 4-(methylamino)-N-[[6-(trifluoromethyl)-3-pyridinyl]methyl]benzamide.
| Compound Name | 4-(methylamino)-N-[[6-(trifluoromethyl)-3-pyridinyl]methyl]benzamide |
|---|---|
| PubChem CID | 71197021 |
| Molecular Formula | C15H14F3N3O |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 4-(methylamino)-N-[[6-(trifluoromethyl)-3-pyridinyl]methyl]benzamide |
| SMILES | CNc1ccc(C(=O)NCc2ccc(C(F)(F)F)nc2)cc1 |
| InChI | InChI=1S/C15H14F3N3O/c1-19-12-5-3-11(4-6-12)14(22)21-9-10-2-7-13(20-8-10)15(16,17)18/h2-8,19H,9H2,1H3,(H,21,22) |
| InChIKey | UREKNOVTOLSIER-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |