C22H18F3N2O3S- — CID 174733775
[3-(4-methylphenyl)-5-[[6-(trifluoromethyl)-3-pyridinyl]methylcarbamoyl]phenyl]methanesulfinate (PubChem CID 174733775) has the molecular formula C22H18F3N2O3S- and a molecular weight of 447.46 g/mol. Its IUPAC name is [3-(4-methylphenyl)-5-[[6-(trifluoromethyl)-3-pyridinyl]methylcarbamoyl]phenyl]methanesulfinate.
| Compound Name | [3-(4-methylphenyl)-5-[[6-(trifluoromethyl)-3-pyridinyl]methylcarbamoyl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174733775 |
| Molecular Formula | C22H18F3N2O3S- |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | [3-(4-methylphenyl)-5-[[6-(trifluoromethyl)-3-pyridinyl]methylcarbamoyl]phenyl]methanesulfinate |
| SMILES | Cc1ccc(-c2cc(CS(=O)[O-])cc(C(=O)NCc3ccc(C(F)(F)F)nc3)c2)cc1 |
| InChI | InChI=1S/C22H19F3N2O3S/c1-14-2-5-17(6-3-14)18-8-16(13-31(29)30)9-19(10-18)21(28)27-12-15-4-7-20(26-11-15)22(23,24)25/h2-11H,12-13H2,1H3,(H,27,28)(H,29,30)/p-1 |
| InChIKey | CMZNRLDXEHBZNU-UHFFFAOYSA-M |
| XLogP | 4.38 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|