C29H28N2O2 — CID 143959958
3-(4-ethylphenyl)-5-[4-(hydroxymethyl)phenyl]-N-[(6-methyl-3-pyridinyl)methyl]benzamide (PubChem CID 143959958) has the molecular formula C29H28N2O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-5-[4-(hydroxymethyl)phenyl]-N-[(6-methyl-3-pyridinyl)methyl]benzamide.
| Compound Name | 3-(4-ethylphenyl)-5-[4-(hydroxymethyl)phenyl]-N-[(6-methyl-3-pyridinyl)methyl]benzamide |
|---|---|
| PubChem CID | 143959958 |
| Molecular Formula | C29H28N2O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 3-(4-ethylphenyl)-5-[4-(hydroxymethyl)phenyl]-N-[(6-methyl-3-pyridinyl)methyl]benzamide |
| SMILES | CCc1ccc(-c2cc(C(=O)NCc3ccc(C)nc3)cc(-c3ccc(CO)cc3)c2)cc1 |
| InChI | InChI=1S/C29H28N2O2/c1-3-21-6-10-24(11-7-21)26-14-27(25-12-8-22(19-32)9-13-25)16-28(15-26)29(33)31-18-23-5-4-20(2)30-17-23/h4-17,32H,3,18-19H2,1-2H3,(H,31,33) |
| InChIKey | SFDLUASFQGQNPY-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |