C25H26N2O4 — CID 143859768
3-(4-hydroxyoxolan-3-yl)oxy-5-(4-methylphenyl)-N-[(6-methyl-3-pyridinyl)methyl]benzamide (PubChem CID 143859768) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is 3-(4-hydroxyoxolan-3-yl)oxy-5-(4-methylphenyl)-N-[(6-methyl-3-pyridinyl)methyl]benzamide.
| Compound Name | 3-(4-hydroxyoxolan-3-yl)oxy-5-(4-methylphenyl)-N-[(6-methyl-3-pyridinyl)methyl]benzamide |
|---|---|
| PubChem CID | 143859768 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 3-(4-hydroxyoxolan-3-yl)oxy-5-(4-methylphenyl)-N-[(6-methyl-3-pyridinyl)methyl]benzamide |
| SMILES | Cc1ccc(-c2cc(OC3COCC3O)cc(C(=O)NCc3ccc(C)nc3)c2)cc1 |
| InChI | InChI=1S/C25H26N2O4/c1-16-3-7-19(8-4-16)20-9-21(11-22(10-20)31-24-15-30-14-23(24)28)25(29)27-13-18-6-5-17(2)26-12-18/h3-12,23-24,28H,13-15H2,1-2H3,(H,27,29) |
| InChIKey | YCNMUAWMRHRWJX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |