C29H28N3O+ — CID 91550432
methyl-methylidene-[3-[3-(4-methylphenyl)-5-[(6-methyl-3-pyridinyl)methylcarbamoyl]phenyl]phenyl]azanium (PubChem CID 91550432) has the molecular formula C29H28N3O+ and a molecular weight of 434.56 g/mol. Its IUPAC name is methyl-methylidene-[3-[3-(4-methylphenyl)-5-[(6-methyl-3-pyridinyl)methylcarbamoyl]phenyl]phenyl]azanium.
| Compound Name | methyl-methylidene-[3-[3-(4-methylphenyl)-5-[(6-methyl-3-pyridinyl)methylcarbamoyl]phenyl]phenyl]azanium |
|---|---|
| PubChem CID | 91550432 |
| Molecular Formula | C29H28N3O+ |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | methyl-methylidene-[3-[3-(4-methylphenyl)-5-[(6-methyl-3-pyridinyl)methylcarbamoyl]phenyl]phenyl]azanium |
| SMILES | C=[N+](C)c1cccc(-c2cc(C(=O)NCc3ccc(C)nc3)cc(-c3ccc(C)cc3)c2)c1 |
| InChI | InChI=1S/C29H27N3O/c1-20-8-12-23(13-9-20)25-14-26(24-6-5-7-28(17-24)32(3)4)16-27(15-25)29(33)31-19-22-11-10-21(2)30-18-22/h5-18H,3,19H2,1-2,4H3/p+1 |
| InChIKey | UMSNUZSBDHBUOQ-UHFFFAOYSA-O |
| XLogP | 5.94 |
| TPSA | 45.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|