C16H21ClN2 — CID 143694178
(3E,5Z)-N-[(6-chloro-3-pyridinyl)methyl]octa-1,3,5,7-tetraen-4-amine;ethane (PubChem CID 143694178) has the molecular formula C16H21ClN2 and a molecular weight of 276.81 g/mol. Its IUPAC name is (3E,5Z)-N-[(6-chloro-3-pyridinyl)methyl]octa-1,3,5,7-tetraen-4-amine;ethane.
| Compound Name | (3E,5Z)-N-[(6-chloro-3-pyridinyl)methyl]octa-1,3,5,7-tetraen-4-amine;ethane |
|---|---|
| PubChem CID | 143694178 |
| Molecular Formula | C16H21ClN2 |
| Molecular Weight | 276.81 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (3E,5Z)-N-[(6-chloro-3-pyridinyl)methyl]octa-1,3,5,7-tetraen-4-amine;ethane |
| SMILES | C=C/C=C\C(=C/C=C)NCc1ccc(Cl)nc1.CC |
| InChI | InChI=1S/C14H15ClN2.C2H6/c1-3-5-7-13(6-4-2)16-10-12-8-9-14(15)17-11-12;1-2/h3-9,11,16H,1-2,10H2;1-2H3/b7-5-,13-6+; |
| InChIKey | ROFRWWGYRFYWMG-XTMQYXHHSA-N |
| XLogP | 4.66 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.81 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|