C13H14ClN — CID 123249942
2-chloro-5-(4-methylhepta-2,4,6-trienyl)pyridine (PubChem CID 123249942) has the molecular formula C13H14ClN and a molecular weight of 219.71 g/mol. Its IUPAC name is 2-chloro-5-(4-methylhepta-2,4,6-trienyl)pyridine.
| Compound Name | 2-chloro-5-(4-methylhepta-2,4,6-trienyl)pyridine |
|---|---|
| PubChem CID | 123249942 |
| Molecular Formula | C13H14ClN |
| Molecular Weight | 219.71 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 2-chloro-5-(4-methylhepta-2,4,6-trienyl)pyridine |
| SMILES | C=CC=C(C)C=CCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C13H14ClN/c1-3-5-11(2)6-4-7-12-8-9-13(14)15-10-12/h3-6,8-10H,1,7H2,2H3 |
| InChIKey | DLMUYFZCMKDCMO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.71 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|