C8H11ClN2 — CID 12056677
1-(6-chloro-3-pyridinyl)-N,N-dimethylmethanamine (PubChem CID 12056677) has the molecular formula C8H11ClN2 and a molecular weight of 170.64 g/mol. Its IUPAC name is 1-(6-chloro-3-pyridinyl)-N,N-dimethylmethanamine.
| Compound Name | 1-(6-chloro-3-pyridinyl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 12056677 |
| Molecular Formula | C8H11ClN2 |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 1-(6-chloro-3-pyridinyl)-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C8H11ClN2/c1-11(2)6-7-3-4-8(9)10-5-7/h3-5H,6H2,1-2H3 |
| InChIKey | HVWFBPPAYRVHFD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|