C13H20ClN3 — CID 79121749
4-N-[(6-chloro-3-pyridinyl)methyl]-4-N-methylcyclohexane-1,4-diamine (PubChem CID 79121749) has the molecular formula C13H20ClN3 and a molecular weight of 253.78 g/mol. Its IUPAC name is 4-N-[(6-chloro-3-pyridinyl)methyl]-4-N-methylcyclohexane-1,4-diamine.
| Compound Name | 4-N-[(6-chloro-3-pyridinyl)methyl]-4-N-methylcyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 79121749 |
| Molecular Formula | C13H20ClN3 |
| Molecular Weight | 253.78 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 4-N-[(6-chloro-3-pyridinyl)methyl]-4-N-methylcyclohexane-1,4-diamine |
| SMILES | CN(Cc1ccc(Cl)nc1)C1CCC(N)CC1 |
| InChI | InChI=1S/C13H20ClN3/c1-17(12-5-3-11(15)4-6-12)9-10-2-7-13(14)16-8-10/h2,7-8,11-12H,3-6,9,15H2,1H3 |
| InChIKey | DVXXNJNGJRUWFU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.78 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|