C11H14F2N2 — CID 155399186
N-[[6-(difluoromethyl)-3-pyridinyl]methyl]-N-methylcyclopropanamine (PubChem CID 155399186) has the molecular formula C11H14F2N2 and a molecular weight of 212.24 g/mol. Its IUPAC name is N-[[6-(difluoromethyl)-3-pyridinyl]methyl]-N-methylcyclopropanamine.
| Compound Name | N-[[6-(difluoromethyl)-3-pyridinyl]methyl]-N-methylcyclopropanamine |
|---|---|
| PubChem CID | 155399186 |
| Molecular Formula | C11H14F2N2 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | N-[[6-(difluoromethyl)-3-pyridinyl]methyl]-N-methylcyclopropanamine |
| SMILES | CN(Cc1ccc(C(F)F)nc1)C1CC1 |
| InChI | InChI=1S/C11H14F2N2/c1-15(9-3-4-9)7-8-2-5-10(11(12)13)14-6-8/h2,5-6,9,11H,3-4,7H2,1H3 |
| InChIKey | JWVUSNWMNGLGRH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |