C15H23ClF2N2 — CID 120845420
N-[[4-(difluoromethyl)phenyl]methyl]-N-methylazepan-4-amine;hydrochloride (PubChem CID 120845420) has the molecular formula C15H23ClF2N2 and a molecular weight of 304.81 g/mol. Its IUPAC name is N-[[4-(difluoromethyl)phenyl]methyl]-N-methylazepan-4-amine;hydrochloride.
| Compound Name | N-[[4-(difluoromethyl)phenyl]methyl]-N-methylazepan-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120845420 |
| Molecular Formula | C15H23ClF2N2 |
| Molecular Weight | 304.81 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | N-[[4-(difluoromethyl)phenyl]methyl]-N-methylazepan-4-amine;hydrochloride |
| SMILES | CN(Cc1ccc(C(F)F)cc1)C1CCCNCC1.Cl |
| InChI | InChI=1S/C15H22F2N2.ClH/c1-19(14-3-2-9-18-10-8-14)11-12-4-6-13(7-5-12)15(16)17;/h4-7,14-15,18H,2-3,8-11H2,1H3;1H |
| InChIKey | NHSGDZWDDFFCJO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.81 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |