C12H20ClN3 — CID 71641683
N-methyl-N-(pyridin-4-ylmethyl)piperidin-4-amine;hydrochloride (PubChem CID 71641683) has the molecular formula C12H20ClN3 and a molecular weight of 241.77 g/mol. Its IUPAC name is N-methyl-N-(pyridin-4-ylmethyl)piperidin-4-amine;hydrochloride.
| Compound Name | N-methyl-N-(pyridin-4-ylmethyl)piperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 71641683 |
| Molecular Formula | C12H20ClN3 |
| Molecular Weight | 241.77 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | N-methyl-N-(pyridin-4-ylmethyl)piperidin-4-amine;hydrochloride |
| SMILES | CN(Cc1ccncc1)C1CCNCC1.Cl |
| InChI | InChI=1S/C12H19N3.ClH/c1-15(12-4-8-14-9-5-12)10-11-2-6-13-7-3-11;/h2-3,6-7,12,14H,4-5,8-10H2,1H3;1H |
| InChIKey | WSHSCSLLGYUESV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.77 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |