C14H19F3N2O — CID 43607736
N-methyl-N-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-amine (PubChem CID 43607736) has the molecular formula C14H19F3N2O and a molecular weight of 288.31 g/mol. Its IUPAC name is N-methyl-N-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-amine.
| Compound Name | N-methyl-N-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 43607736 |
| Molecular Formula | C14H19F3N2O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | N-methyl-N-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-amine |
| SMILES | CN(Cc1ccc(OC(F)(F)F)cc1)C1CCNCC1 |
| InChI | InChI=1S/C14H19F3N2O/c1-19(12-6-8-18-9-7-12)10-11-2-4-13(5-3-11)20-14(15,16)17/h2-5,12,18H,6-10H2,1H3 |
| InChIKey | VWMIULHLWKFHLU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |